Sodium glycerophosphate

Identification

Summary

Sodium glycerophosphate is a medication used to treat hypophosphatemia.

Brand Names
Glycophos, Olimel, Periolimel
Generic Name
Sodium glycerophosphate
DrugBank Accession Number
DB09561
Background

Sodium glycerophosphate is one of several glycerophosphate salts. It is used clinically to treat or prevent low phosphate levels Label. Glycerophosphate is hydrolyzed to inorganic phosphate and glycerol in the body 1. The extent of this reaction is dependent on the activity of serum alkaline phosphatases.

Type
Small Molecule
Groups
Approved
Structure
Thumb
Weight
Average: 216.036
Monoisotopic: 215.9775635
Chemical Formula
C3H7Na2O6P
Synonyms
  • Disodium glycerol phosphate
  • Sodium glycerophosphate anhydrous

Pharmacology

Indication

Sodium glycerophosphate is indicated for use as a source of phosphate in total parenteral nutrition Label. It is used in combination with amino acids, dextrose, lipid emulsions, and other electrolytes.

Pharmacology
Reduce drug development failure rates
Build, train, & validate machine-learning models
with evidence-based and structured datasets.
See how
Build, train, & validate predictive machine-learning models with structured datasets.
See how
Associated Therapies
Contraindications & Blackbox Warnings
Contraindications
Avoid life-threatening adverse drug events
Improve clinical decision support with information on contraindications & blackbox warnings, population restrictions, harmful risks, & more.
Learn more
Avoid life-threatening adverse drug events & improve clinical decision support.
Learn more
Pharmacodynamics

Glycerophosphate acts as a source of inorganic phosphate through hydrolysis 1.

Mechanism of action

Sodium glycerophosphate acts as a donor of inorganic phosphate 1. See Monopotassium phosphate for a description of phosphate's role in the body.

Absorption

Peak serum phosphate concentration is reached in 4h 1.

Volume of distribution

Not Available

Protein binding

Not Available

Metabolism

Glycerophosphate is hydrolyzed to form inorganic phosphate 1. The extent of this reaction is dependent on serum alkaline phosphatase activity.

Route of elimination

Inorganic phosphate produced is eliminated in the urine 1. There may be a very small amount of glycerophosphate excreted in the urine unchanged.

Half-life

Inorganic phosphate has a half-life of elimination of 2.06h 1.

Clearance

Not Available

Adverse Effects
Adverseeffects
Improve decision support & research outcomes
With structured adverse effects data, including: blackbox warnings, adverse reactions, warning & precautions, & incidence rates.
Learn more
Improve decision support & research outcomes with our structured adverse effects data.
Learn more
Toxicity

Not Available

Pathways
Not Available
Pharmacogenomic Effects/ADRs
Not Available

Interactions

Drug Interactions
This information should not be interpreted without the help of a healthcare provider. If you believe you are experiencing an interaction, contact a healthcare provider immediately. The absence of an interaction does not necessarily mean no interactions exist.
Not Available
Food Interactions
No interactions found.

Products

Products2
Drug product information from 10+ global regions
Our datasets provide approved product information including:
dosage, form, labeller, route of administration, and marketing period.
Access now
Access drug product information from over 10 global regions.
Access now
Product Ingredients
IngredientUNIICASInChI Key
Sodium glycerophosphate hydrateRCS9EQ01V455073-41-1OFNNKPAERNWEDD-UHFFFAOYSA-L
Active Moieties
NameKindUNIICASInChI Key
Sodium cationionicLYR4M0NH3717341-25-2FKNQFGJONOIPTF-UHFFFAOYSA-N
International/Other Brands
Glycophos (Fresenius Kabi Norge)
Brand Name Prescription Products
NameDosageStrengthRouteLabellerMarketing StartMarketing EndRegionImage
GlycophosInjection, solution216 mg/1mLIntravenousFresenius Kabi USA, LLC2013-05-13Not applicableUS flag
Mixture Products
NameIngredientsDosageRouteLabellerMarketing StartMarketing EndRegionImage
AMINOMIX 1 INTRAVENÖZ İNZFÜZYON, 1000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-142019-07-16Turkey flag
AMINOMIX 1 INTRAVENÖZ İNZFÜZYON, 1500 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-142019-07-16Turkey flag
AMINOMIX 1 INTRAVENÖZ İNZFÜZYON, 2000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-142019-07-16Turkey flag
AMINOMIX 1 NOVUM 1500 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 1 NOVUM IV INFUZYON ICIN STERIL APIROJEN COZELTI 2000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 1 NOVUM IV INFUZYON ICIN STERIL APIROJEN COZELTI,1000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (200 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 2 NOVUM 1000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (120 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 2 NOVUM 1500 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (120 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 2 NOVUM 2000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (120 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
AMINOMIX 2 SOLÜSYON, 1000 MLSodium glycerophosphate (4.59 g/500mL) + Acetic acid (4.5 g/500mL) + Alanine (7 g/500mL) + Arginine (6 g/500mL) + Calcium chloride (0.294 g/500mL) + D-glucose monohydrate (120 g/500mL) + Glycine (5.5 g/500mL) + Histidine (1.5 g/500mL) + Isoleucine (2.5 g/500mL) + Leucine (3.7 g/500mL) + Lysine hydrochloride (3.3 g/500mL) + Magnesium chloride hexahydrate (0.61 g/500mL) + Methionine (2.15 g/500mL) + Phenylalanine (2.55 g/500mL) + Potassium chloride (1.47 g/500mL) + Proline (5.6 g/500mL) + Serine (3.25 g/500mL) + Sodium chloride (1.169 g/500mL) + Taurine (0.5 g/500mL) + Threonine (2.2 g/500mL) + Tryptophan (1 g/500mL) + Tyrosine (0.2 g/500mL) + Valine (3.1 g/500mL) + Zinc chloride (5.45 mg/500mL)Injection, solutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-142019-07-16Turkey flag
Unapproved/Other Products
NameIngredientsDosageRouteLabellerMarketing StartMarketing EndRegionImage
GlycophosSodium glycerophosphate (216 mg/1mL)Injection, solutionIntravenousFresenius Kabi USA, LLC2013-05-13Not applicableUS flag
GLYCOPHOSE IV INFUZYON ICIN STERIL APIROJEN SOLUSYON 10X20 ML FLAKONSodium glycerophosphate hydrate (216 mg)SolutionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
KABIVEN 1026 MLSodium glycerophosphate (1.5 g) + Alanine (4.8 g) + Arginine (3.4 g) + Aspartic acid (1 g) + Calcium chloride dihydrate (0.29 g) + D-glucose monohydrate (110 g) + Glutamic acid (1.7 g) + Glycine (2.4 g) + Histidine (2 g) + Isoleucine (1.7 g) + Leucine (2.4 g) + Lysine (2.7 g) + Magnesium sulfate heptahydrate (0.99 g) + Methionine (1.7 g) + Phenylalanine (2.4 g) + Potassium chloride (1.8 g) + Proline (2 g) + Serine (1.4 g) + Sodium acetate trihydrate (2.5 g) + Soybean oil (40 g) + Threonine (1.7 g) + Tryptophan (0.57 g) + Tyrosine (0.07 g) + Valine (2.2 g)InjectionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
KABIVEN 1540 MLSodium glycerophosphate (2.3 g) + Alanine (7.2 g) + Arginine (5.1 g) + Aspartic acid (1.5 g) + Calcium chloride dihydrate (0.44 g) + D-glucose monohydrate (165 g) + Glutamic acid (2.5 g) + Glycine (3.6 g) + Histidine (3.1 g) + Isoleucine (2.5 g) + Leucine (3.6 g) + Lysine (4.1 g) + Magnesium sulfate heptahydrate (1.5 g) + Methionine (2.5 g) + Phenylalanine (3.6 g) + Potassium chloride (2.7 g) + Proline (3.1 g) + Serine (2 g) + Sodium acetate trihydrate (3.7 g) + Soybean oil (60 g) + Threonine (2.5 g) + Tryptophan (0.86 g) + Tyrosine (0.1 g) + Valine (3.3 g)InjectionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
KABIVEN 2053 MLSodium glycerophosphate (3 g) + Alanine (9.6 g) + Arginine (6.8 g) + Aspartic acid (2 g) + Calcium chloride dihydrate (0.59 g) + D-glucose monohydrate (220 g) + Glutamic acid (3.4 g) + Glycine (4.7 g) + Histidine (4.1 g) + Isoleucine (3.4 g) + Leucine (4.7 g) + Lysine (5.4 g) + Magnesium sulfate heptahydrate (2 g) + Methionine (3.4 g) + Phenylalanine (4.7 g) + Potassium chloride (3.6 g) + Proline (4.1 g) + Serine (2.7 g) + Sodium acetate trihydrate (4.9 g) + Soybean oil (80 g) + Threonine (3.4 g) + Tryptophan (1.1 g) + Tyrosine (0.14 g) + Valine (4.4 g)InjectionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
KABIVEN PERIPHERAL 1440 MLSodium glycerophosphate (1.5 g) + Alanine (4.8 g) + Arginine (3.4 g) + Aspartic acid (1 g) + Calcium chloride dihydrate (0.29 g) + D-glucose monohydrate (107 g) + Glutamic acid (1.7 g) + Glycine (2.4 g) + Histidine (2 g) + Isoleucine (1.7 g) + Leucine (2.4 g) + Lysine (2.7 g) + Magnesium sulfate heptahydrate (0.99 g) + Methionine (1.7 g) + Phenylalanine (2.4 g) + Potassium chloride (1.8 g) + Proline (2 g) + Serine (1.4 g) + Sodium acetate trihydrate (2.5 g) + Soybean oil (51 g) + Threonine (1.7 g) + Tryptophan (0.57 g) + Tyrosine (0.069 g) + Valine (2.2 g)InjectionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag
KABIVEN PERIPHERAL 1920 MLSodium glycerophosphate (2 g) + Alanine (6.4 g) + Arginine (4.5 g) + Aspartic acid (1.4 g) + Calcium chloride dihydrate (0.39 g) + D-glucose monohydrate (143 g) + Glutamic acid (2.2 g) + Glycine (3.2 g) + Histidine (2.7 g) + Isoleucine (2.2 g) + Leucine (3.2 g) + Lysine (3.6 g) + Magnesium sulfate heptahydrate (1.3 g) + Methionine (2.2 g) + Phenylalanine (3.2 g) + Potassium chloride (2.4 g) + Proline (2.7 g) + Serine (1.8 g) + Sodium acetate trihydrate (3.3 g) + Soybean oil (68 g) + Threonine (2.2 g) + Tryptophan (0.76 g) + Tyrosine (0.092 g) + Valine (2.9 g)InjectionIntravenousFRESENİUS KABİ İLAÇ SAN. VE TİC. LTD. ŞTİ.2020-08-14Not applicableTurkey flag

Categories

ATC Codes
B05XA14 — Sodium glycerophosphate
Drug Categories
Chemical TaxonomyProvided by Classyfire
Description
This compound belongs to the class of organic compounds known as glycerophosphates. These are compounds containing a glycerol linked to a phosphate group.
Kingdom
Organic compounds
Super Class
Lipids and lipid-like molecules
Class
Glycerophospholipids
Sub Class
Glycerophosphates
Direct Parent
Glycerophosphates
Alternative Parents
Alkyl phosphates / Secondary alcohols / 1,2-diols / Primary alcohols / Organic sodium salts / Organic oxides / Hydrocarbon derivatives
Substituents
1,2-diol / Alcohol / Aliphatic acyclic compound / Alkyl phosphate / Hydrocarbon derivative / Organic alkali metal salt / Organic oxide / Organic oxygen compound / Organic phosphoric acid derivative / Organic salt
Molecular Framework
Aliphatic acyclic compounds
External Descriptors
Not Available
Affected organisms
Not Available

Chemical Identifiers

UNII
G43E72677U
CAS number
1334-74-3
InChI Key
GEKBIENFFVFKRG-UHFFFAOYSA-L
InChI
InChI=1S/C3H9O6P.2Na/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2
IUPAC Name
disodium 3-(phosphonooxy)propane-1,2-diol
SMILES
[Na+].[Na+].OCC(O)COP([O-])([O-])=O

References

General References
  1. Topp H, Hochfeld O, Bark S, Grossmann M, Joukhadar C, Westphal M, Straatsma H, Rothenburger M: Glycerophosphate is interchangeable with inorganic phosphate in terms of safety and serum pharmacokinetics. Pharmacology. 2011;88(3-4):193-200. doi: 10.1159/000331341. Epub 2011 Oct 4. [Article]
PubChem Compound
22251426
PubChem Substance
347827880
ChemSpider
14071
RxNav
1595589
ChEMBL
CHEMBL3040581
FDA label
Download (806 KB)
MSDS
Download (46.7 KB)

Clinical Trials

Clinical Trials
PhaseStatusPurposeConditionsCount
4Not Yet RecruitingDiagnosticHypophosphatemia1
4TerminatedSupportive CareCancer-related Malnutrition1
4TerminatedSupportive CareCritically Ill Patients1
4WithdrawnSupportive CareMalnutrition1
3CompletedTreatmentParenteral Feedings / Surgery1
3CompletedTreatmentParenteral Nutrition / Surgery1
3CompletedTreatmentParenting2
3TerminatedTreatmentMalignant Neoplasm of Pancreas1
Not AvailableCompletedTreatmentMalignancies, Hematologic1

Pharmacoeconomics

Manufacturers
Not Available
Packagers
Not Available
Dosage Forms
FormRouteStrength
SolutionIntravenous
Injection, solutionIntravenous
EmulsionParenteral
Injection, solutionIntramuscular
SyrupOral
TabletOral
InjectionIntravenous
Injection, solutionIntravenous216 mg/1mL
SolutionIntravenous216 mg/1ml
Injection, solution, concentrateIntravenous
Injection, solutionIntravenous
SolutionIntravenous216 mg
SolutionIntravenous
Injection, emulsionIntravenous
InjectionIntravenous
Injection, emulsionParenteral
EmulsionIntravenous
Injection, emulsion; injection, solutionIntravenous
EmulsionIntravenous4 g
EmulsionIntravenous3 g
LiquidOral
Prices
Not Available
Patents
Not Available

Properties

State
Solid
Experimental Properties
PropertyValueSource
water solubilitySolubleMSDS
Predicted Properties
PropertyValueSource
Water Solubility81.5 mg/mLALOGPS
logP-1.4ALOGPS
logP-2ChemAxon
logS-0.42ALOGPS
pKa (Strongest Acidic)1.51ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge-2ChemAxon
Hydrogen Acceptor Count5ChemAxon
Hydrogen Donor Count2ChemAxon
Polar Surface Area112.88 Å2ChemAxon
Rotatable Bond Count4ChemAxon
Refractivity29.15 m3·mol-1ChemAxon
Polarizability12.87 Å3ChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted ADMET Features
Not Available

Spectra

Mass Spec (NIST)
Not Available
Spectra
Not Available

Drug created on November 30, 2015 19:10 / Updated on February 13, 2021 11:02